C15H20I3N3O6 — CID 88523653
1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(methylamino)benzene-1,3-dicarboxamide (PubChem CID 88523653) has the molecular formula C15H20I3N3O6 and a molecular weight of 719.05 g/mol. Its IUPAC name is 1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(methylamino)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(methylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 88523653 |
| Molecular Formula | C15H20I3N3O6 |
| Molecular Weight | 719.05 g/mol |
| Exact Mass | 718.85 |
| IUPAC Name | 1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(methylamino)benzene-1,3-dicarboxamide |
| SMILES | CNc1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C15H20I3N3O6/c1-19-13-11(17)8(14(26)20-2-6(24)4-22)10(16)9(12(13)18)15(27)21-3-7(25)5-23/h6-7,19,22-25H,2-5H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | VRWCAMKDECJJIY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.05 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|