C14H16I3N3O6 — CID 90370677
3-N-(2,3-dihydroxypropyl)-5-[(3-hydroxy-2-oxopropyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide (PubChem CID 90370677) has the molecular formula C14H16I3N3O6 and a molecular weight of 703.01 g/mol. Its IUPAC name is 3-N-(2,3-dihydroxypropyl)-5-[(3-hydroxy-2-oxopropyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2,3-dihydroxypropyl)-5-[(3-hydroxy-2-oxopropyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 90370677 |
| Molecular Formula | C14H16I3N3O6 |
| Molecular Weight | 703.01 g/mol |
| Exact Mass | 702.82 |
| IUPAC Name | 3-N-(2,3-dihydroxypropyl)-5-[(3-hydroxy-2-oxopropyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1c(I)c(NCC(=O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C14H16I3N3O6/c15-9-7(13(18)25)10(16)12(19-1-5(23)3-21)11(17)8(9)14(26)20-2-6(24)4-22/h6,19,21-22,24H,1-4H2,(H2,18,25)(H,20,26) |
| InChIKey | CZZBBYONDSOYKL-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.01 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|