C14H17I3N2O6 — CID 87217286
3-N,5-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide (PubChem CID 87217286) has the molecular formula C14H17I3N2O6 and a molecular weight of 690.01 g/mol. Its IUPAC name is 3-N,5-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide.
| Compound Name | 3-N,5-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87217286 |
| Molecular Formula | C14H17I3N2O6 |
| Molecular Weight | 690.01 g/mol |
| Exact Mass | 689.82 |
| IUPAC Name | 3-N,5-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1c(I)c(CC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C14H17I3N2O6/c15-10-7(1-5(22)3-20)11(16)9(12(17)8(10)13(18)24)14(25)19-2-6(23)4-21/h5-6,20-23H,1-4H2,(H2,18,24)(H,19,25) |
| InChIKey | XJVCYFYBZQUNJR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.01 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|