C11H9I3O6 — CID 150667538
5-(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxylic acid (PubChem CID 150667538) has the molecular formula C11H9I3O6 and a molecular weight of 617.90 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxylic acid.
| Compound Name | 5-(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150667538 |
| Molecular Formula | C11H9I3O6 |
| Molecular Weight | 617.90 g/mol |
| Exact Mass | 617.75 |
| IUPAC Name | 5-(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1c(I)c(CC(O)CO)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C11H9I3O6/c12-7-4(1-3(16)2-15)8(13)6(11(19)20)9(14)5(7)10(17)18/h3,15-16H,1-2H2,(H,17,18)(H,19,20) |
| InChIKey | JFEMRMKPMATRGL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.90 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|