C9H7F5O2 — CID 125488813
(2S)-3-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diol (PubChem CID 125488813) has the molecular formula C9H7F5O2 and a molecular weight of 242.14 g/mol. Its IUPAC name is (2S)-3-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diol.
| Compound Name | (2S)-3-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 125488813 |
| Molecular Formula | C9H7F5O2 |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | (2S)-3-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diol |
| SMILES | OC[C@@H](O)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H7F5O2/c10-5-4(1-3(16)2-15)6(11)8(13)9(14)7(5)12/h3,15-16H,1-2H2/t3-/m0/s1 |
| InChIKey | IKTGWWPPJYREEL-VKHMYHEASA-N |
| XLogP | 1.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|