About 2,3-dihydroxypropyl-λ2-stannane
2,3-dihydroxypropyl-λ2-stannane (PubChem CID 174786480) has the molecular formula C3H8O2Sn
and a molecular weight of 194.81 g/mol. Its IUPAC name is 2,3-dihydroxypropyl-λ2-stannane.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl-λ2-stannane |
| PubChem CID | 174786480 |
| Molecular Formula | C3H8O2Sn |
| Molecular Weight | 194.81 g/mol |
| Exact Mass | 195.95 |
| IUPAC Name | 2,3-dihydroxypropyl-λ2-stannane |
| SMILES | OCC(O)C[SnH] |
| InChI | InChI=1S/C3H7O2.Sn.H/c1-3(5)2-4;;/h3-5H,1-2H2;; |
| InChIKey | KASKLYYPXASKOH-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.81 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydroxypropyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl-λ2-stannane?
The IUPAC name of 2,3-dihydroxypropyl-λ2-stannane (CID 174786480) is 2,3-dihydroxypropyl-λ2-stannane.
What is the SMILES notation for 2,3-dihydroxypropyl-λ2-stannane?
The canonical SMILES for 2,3-dihydroxypropyl-λ2-stannane is OCC(O)C[SnH].
What is the InChIKey of 2,3-dihydroxypropyl-λ2-stannane?
The InChIKey is KASKLYYPXASKOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O2.Sn.H/c1-3(5)2-4;;/h3-5H,1-2H2;;.
What are the key properties of 2,3-dihydroxypropyl-λ2-stannane?
2,3-dihydroxypropyl-λ2-stannane has a molecular weight of 194.81 g/mol, XLogP of -1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl-λ2-stannane is sourced from PubChem (CID 174786480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).