C3H10MgO5 — CID 159793120
magnesium;propane-1,2,3-triol;dihydroxide (PubChem CID 159793120) has the molecular formula C3H10MgO5 and a molecular weight of 150.41 g/mol. Its IUPAC name is magnesium;propane-1,2,3-triol;dihydroxide.
| Compound Name | magnesium;propane-1,2,3-triol;dihydroxide |
|---|---|
| PubChem CID | 159793120 |
| Molecular Formula | C3H10MgO5 |
| Molecular Weight | 150.41 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | magnesium;propane-1,2,3-triol;dihydroxide |
| SMILES | OCC(O)CO.[Mg+2].[OH-].[OH-] |
| InChI | InChI=1S/C3H8O3.Mg.2H2O/c4-1-3(6)2-5;;;/h3-6H,1-2H2;;2*1H2/q;+2;;/p-2 |
| InChIKey | NIVAZDGMVLZGSZ-UHFFFAOYSA-L |
| XLogP | -2.40 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.41 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |