C7H18O7 — CID 87640100
(2S,3R)-butane-1,2,3,4-tetrol;propane-1,2,3-triol (PubChem CID 87640100) has the molecular formula C7H18O7 and a molecular weight of 214.21 g/mol. Its IUPAC name is (2S,3R)-butane-1,2,3,4-tetrol;propane-1,2,3-triol.
| Compound Name | (2S,3R)-butane-1,2,3,4-tetrol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87640100 |
| Molecular Formula | C7H18O7 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (2S,3R)-butane-1,2,3,4-tetrol;propane-1,2,3-triol |
| SMILES | OCC(O)CO.OC[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H10O4.C3H8O3/c5-1-3(7)4(8)2-6;4-1-3(6)2-5/h3-8H,1-2H2;3-6H,1-2H2/t3-,4+; |
| InChIKey | XBJMQLRJKLDOKY-HKTIBRIUSA-N |
| XLogP | -3.98 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |