C6H14O5 — CID 6451627
(2R,3R,5R)-hexane-1,2,3,5,6-pentol (PubChem CID 6451627) has the molecular formula C6H14O5 and a molecular weight of 166.17 g/mol. Its IUPAC name is (2R,3R,5R)-hexane-1,2,3,5,6-pentol.
| Compound Name | (2R,3R,5R)-hexane-1,2,3,5,6-pentol |
|---|---|
| PubChem CID | 6451627 |
| Molecular Formula | C6H14O5 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (2R,3R,5R)-hexane-1,2,3,5,6-pentol |
| SMILES | OC[C@H](O)C[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O5/c7-2-4(9)1-5(10)6(11)3-8/h4-11H,1-3H2/t4-,5-,6-/m1/s1 |
| InChIKey | RUIACMUVCHMOMF-HSUXUTPPSA-N |
| XLogP | -2.56 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |