C3H12Cl4O3 — CID 163704230
propane-1,2,3-triol;tetrahydrochloride (PubChem CID 163704230) has the molecular formula C3H12Cl4O3 and a molecular weight of 237.94 g/mol. Its IUPAC name is propane-1,2,3-triol;tetrahydrochloride.
| Compound Name | propane-1,2,3-triol;tetrahydrochloride |
|---|---|
| PubChem CID | 163704230 |
| Molecular Formula | C3H12Cl4O3 |
| Molecular Weight | 237.94 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | propane-1,2,3-triol;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.4ClH/c4-1-3(6)2-5;;;;/h3-6H,1-2H2;4*1H |
| InChIKey | KDQFPWRQHJYWPP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.94 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |