C3H8FeO4 — CID 157365497
iron(2+);oxygen(2-);propane-1,2,3-triol (PubChem CID 157365497) has the molecular formula C3H8FeO4 and a molecular weight of 163.94 g/mol. Its IUPAC name is iron(2+);oxygen(2-);propane-1,2,3-triol.
| Compound Name | iron(2+);oxygen(2-);propane-1,2,3-triol |
|---|---|
| PubChem CID | 157365497 |
| Molecular Formula | C3H8FeO4 |
| Molecular Weight | 163.94 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | iron(2+);oxygen(2-);propane-1,2,3-triol |
| SMILES | OCC(O)CO.[Fe+2].[O-2] |
| InChI | InChI=1S/C3H8O3.Fe.O/c4-1-3(6)2-5;;/h3-6H,1-2H2;;/q;+2;-2 |
| InChIKey | BJCZRGQRMCMBMU-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.94 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|