C4H12O3S — CID 19920877
methanethiol;propane-1,2,3-triol (PubChem CID 19920877) has the molecular formula C4H12O3S and a molecular weight of 140.20 g/mol. Its IUPAC name is methanethiol;propane-1,2,3-triol.
| Compound Name | methanethiol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 19920877 |
| Molecular Formula | C4H12O3S |
| Molecular Weight | 140.20 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | methanethiol;propane-1,2,3-triol |
| SMILES | CS.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.CH4S/c4-1-3(6)2-5;1-2/h3-6H,1-2H2;2H,1H3 |
| InChIKey | ZDURSRYNHOJKNV-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|