C3H9KO3 — CID 173019679
potassium;hydride;propane-1,2,3-triol (PubChem CID 173019679) has the molecular formula C3H9KO3 and a molecular weight of 132.20 g/mol. Its IUPAC name is potassium;hydride;propane-1,2,3-triol.
| Compound Name | potassium;hydride;propane-1,2,3-triol |
|---|---|
| PubChem CID | 173019679 |
| Molecular Formula | C3H9KO3 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | potassium;hydride;propane-1,2,3-triol |
| SMILES | OCC(O)CO.[H-].[K+] |
| InChI | InChI=1S/C3H8O3.K.H/c4-1-3(6)2-5;;/h3-6H,1-2H2;;/q;+1;-1 |
| InChIKey | GWJCZZGBJWROLA-UHFFFAOYSA-N |
| XLogP | -4.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |