About CID 172765682
CID 172765682 (PubChem CID 172765682) has the molecular formula C3H8KNaO3
and a molecular weight of 154.18 g/mol.
Molecular Properties
| Compound Name | CID 172765682 |
| PubChem CID | 172765682 |
| Molecular Formula | C3H8KNaO3 |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | — |
| SMILES | OCC(O)CO.[K].[Na] |
| InChI | InChI=1S/C3H8O3.K.Na/c4-1-3(6)2-5;;/h3-6H,1-2H2;; |
| InChIKey | MGXBARNOAYYRIK-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 172765682 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172765682?
The IUPAC name of CID 172765682 (CID 172765682) is not available.
What is the SMILES notation for CID 172765682?
The canonical SMILES for CID 172765682 is OCC(O)CO.[K].[Na].
What is the InChIKey of CID 172765682?
The InChIKey is MGXBARNOAYYRIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3.K.Na/c4-1-3(6)2-5;;/h3-6H,1-2H2;;.
What are the key properties of CID 172765682?
CID 172765682 has a molecular weight of 154.18 g/mol, XLogP of -2.43, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172765682 is sourced from PubChem (CID 172765682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).