C10H24O6 — CID 87997487
butane-1,2,3-triol;hexane-1,2,4-triol (PubChem CID 87997487) has the molecular formula C10H24O6 and a molecular weight of 240.30 g/mol. Its IUPAC name is butane-1,2,3-triol;hexane-1,2,4-triol.
| Compound Name | butane-1,2,3-triol;hexane-1,2,4-triol |
|---|---|
| PubChem CID | 87997487 |
| Molecular Formula | C10H24O6 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | butane-1,2,3-triol;hexane-1,2,4-triol |
| SMILES | CC(O)C(O)CO.CCC(O)CC(O)CO |
| InChI | InChI=1S/C6H14O3.C4H10O3/c1-2-5(8)3-6(9)4-7;1-3(6)4(7)2-5/h5-9H,2-4H2,1H3;3-7H,2H2,1H3 |
| InChIKey | CPQHXIPZCUCQHD-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |