C4H10O3 — CID 6398419
(2R,3R)-butane-1,2,3-triol (PubChem CID 6398419) has the molecular formula C4H10O3 and a molecular weight of 106.12 g/mol. Its IUPAC name is (2R,3R)-butane-1,2,3-triol.
| Compound Name | (2R,3R)-butane-1,2,3-triol |
|---|---|
| PubChem CID | 6398419 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | (2R,3R)-butane-1,2,3-triol |
| SMILES | C[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H10O3/c1-3(6)4(7)2-5/h3-7H,2H2,1H3/t3-,4-/m1/s1 |
| InChIKey | YAXKTBLXMTYWDQ-QWWZWVQMSA-N |
| XLogP | -1.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |