C10H26O9S — CID 161456248
bis((2R,3R)-butane-1,2,3,4-tetrol);1-sulfanylethanol (PubChem CID 161456248) has the molecular formula C10H26O9S and a molecular weight of 322.38 g/mol. Its IUPAC name is bis((2R,3R)-butane-1,2,3,4-tetrol);1-sulfanylethanol.
| Compound Name | bis((2R,3R)-butane-1,2,3,4-tetrol);1-sulfanylethanol |
|---|---|
| PubChem CID | 161456248 |
| Molecular Formula | C10H26O9S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | bis((2R,3R)-butane-1,2,3,4-tetrol);1-sulfanylethanol |
| SMILES | CC(O)S.OC[C@@H](O)[C@H](O)CO.OC[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C4H10O4.C2H6OS/c2*5-1-3(7)4(8)2-6;1-2(3)4/h2*3-8H,1-2H2;2-4H,1H3/t2*3-,4-;/m11./s1 |
| InChIKey | WBEOTWUQRGXWAY-VFWVSJHYSA-N |
| XLogP | -4.36 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|