C6H15NO2S — CID 87213631
3-(aminomethyl)-4-sulfanylpentane-1,2-diol (PubChem CID 87213631) has the molecular formula C6H15NO2S and a molecular weight of 165.26 g/mol. Its IUPAC name is 3-(aminomethyl)-4-sulfanylpentane-1,2-diol.
| Compound Name | 3-(aminomethyl)-4-sulfanylpentane-1,2-diol |
|---|---|
| PubChem CID | 87213631 |
| Molecular Formula | C6H15NO2S |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-(aminomethyl)-4-sulfanylpentane-1,2-diol |
| SMILES | CC(S)C(CN)C(O)CO |
| InChI | InChI=1S/C6H15NO2S/c1-4(10)5(2-7)6(9)3-8/h4-6,8-10H,2-3,7H2,1H3 |
| InChIKey | MQRRJMMYMBBNQO-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|