C8H19NO5 — CID 155375199
(2R,3S,4R,6R)-7-amino-5-methylheptane-1,2,3,4,6-pentol (PubChem CID 155375199) has the molecular formula C8H19NO5 and a molecular weight of 209.24 g/mol. Its IUPAC name is (2R,3S,4R,6R)-7-amino-5-methylheptane-1,2,3,4,6-pentol.
| Compound Name | (2R,3S,4R,6R)-7-amino-5-methylheptane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 155375199 |
| Molecular Formula | C8H19NO5 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (2R,3S,4R,6R)-7-amino-5-methylheptane-1,2,3,4,6-pentol |
| SMILES | CC([C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)CN |
| InChI | InChI=1S/C8H19NO5/c1-4(5(11)2-9)7(13)8(14)6(12)3-10/h4-8,10-14H,2-3,9H2,1H3/t4?,5-,6+,7+,8+/m0/s1 |
| InChIKey | YWWWZFNAGSQNFJ-XUQKIGAKSA-N |
| XLogP | -2.98 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |