C6H18NO9P — CID 87218150
(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;phosphoric acid (PubChem CID 87218150) has the molecular formula C6H18NO9P and a molecular weight of 279.18 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;phosphoric acid.
| Compound Name | (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;phosphoric acid |
|---|---|
| PubChem CID | 87218150 |
| Molecular Formula | C6H18NO9P |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;phosphoric acid |
| SMILES | NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=P(O)(O)O |
| InChI | InChI=1S/C6H15NO5.H3O4P/c7-1-3(9)5(11)6(12)4(10)2-8;1-5(2,3)4/h3-6,8-12H,1-2,7H2;(H3,1,2,3,4)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | SPXYWHJQHHTNOR-BTVCFUMJSA-N |
| XLogP | -4.55 |
| TPSA | 204.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|