C6H15O10P — CID 159752699
(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid (PubChem CID 159752699) has the molecular formula C6H15O10P and a molecular weight of 278.15 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid.
| Compound Name | (2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid |
|---|---|
| PubChem CID | 159752699 |
| Molecular Formula | C6H15O10P |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid |
| SMILES | O=C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO.O=P(O)(O)O |
| InChI | InChI=1S/C6H12O6.H3O4P/c7-1-3(9)5(11)6(12)4(10)2-8;1-5(2,3)4/h1,3-6,8-12H,2H2;(H3,1,2,3,4)/t3-,4+,5+,6-;/m1./s1 |
| InChIKey | NDVRKEKNSBMTAX-OLALXQGDSA-N |
| XLogP | -4.31 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|