C5H15O8P — CID 174620761
pentane-1,2,3,4-tetrol;phosphoric acid (PubChem CID 174620761) has the molecular formula C5H15O8P and a molecular weight of 234.14 g/mol. Its IUPAC name is pentane-1,2,3,4-tetrol;phosphoric acid.
| Compound Name | pentane-1,2,3,4-tetrol;phosphoric acid |
|---|---|
| PubChem CID | 174620761 |
| Molecular Formula | C5H15O8P |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | pentane-1,2,3,4-tetrol;phosphoric acid |
| SMILES | CC(O)C(O)C(O)CO.O=P(O)(O)O |
| InChI | InChI=1S/C5H12O4.H3O4P/c1-3(7)5(9)4(8)2-6;1-5(2,3)4/h3-9H,2H2,1H3;(H3,1,2,3,4) |
| InChIKey | MAKBWIUHFAVVJP-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|