C15H36O8 — CID 158918319
(2S)-butan-2-ol;(2S,3S,4R)-hexane-2,3,4-triol;(2R,3R,4S)-pentane-1,2,3,4-tetrol (PubChem CID 158918319) has the molecular formula C15H36O8 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2S)-butan-2-ol;(2S,3S,4R)-hexane-2,3,4-triol;(2R,3R,4S)-pentane-1,2,3,4-tetrol.
| Compound Name | (2S)-butan-2-ol;(2S,3S,4R)-hexane-2,3,4-triol;(2R,3R,4S)-pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 158918319 |
| Molecular Formula | C15H36O8 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2S)-butan-2-ol;(2S,3S,4R)-hexane-2,3,4-triol;(2R,3R,4S)-pentane-1,2,3,4-tetrol |
| SMILES | CC[C@@H](O)[C@@H](O)[C@H](C)O.CC[C@H](C)O.C[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O3.C5H12O4.C4H10O/c1-3-5(8)6(9)4(2)7;1-3(7)5(9)4(8)2-6;1-3-4(2)5/h4-9H,3H2,1-2H3;3-9H,2H2,1H3;4-5H,3H2,1-2H3/t4-,5+,6-;3-,4+,5+;4-/m000/s1 |
| InChIKey | JHMZJAIMQVGGRZ-VXYJUOINSA-N |
| XLogP | -1.64 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |