About butan-2-ol;ethanol
butan-2-ol;ethanol (PubChem CID 174347632) has the molecular formula C18H52O8
and a molecular weight of 396.61 g/mol. Its IUPAC name is butan-2-ol;ethanol.
Molecular Properties
| Compound Name | butan-2-ol;ethanol |
| PubChem CID | 174347632 |
| Molecular Formula | C18H52O8 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | butan-2-ol;ethanol |
| SMILES | CCC(C)O.CCO.CCO.CCO.CCO.CCO.CCO.CCO |
| InChI | InChI=1S/C4H10O.7C2H6O/c1-3-4(2)5;7*1-2-3/h4-5H,3H2,1-2H3;7*3H,2H2,1H3 |
| InChIKey | FDHGYYAMBJWQJJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze butan-2-ol;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;ethanol?
The IUPAC name of butan-2-ol;ethanol (CID 174347632) is butan-2-ol;ethanol.
What is the SMILES notation for butan-2-ol;ethanol?
The canonical SMILES for butan-2-ol;ethanol is CCC(C)O.CCO.CCO.CCO.CCO.CCO.CCO.CCO.
What is the InChIKey of butan-2-ol;ethanol?
The InChIKey is FDHGYYAMBJWQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.7C2H6O/c1-3-4(2)5;7*1-2-3/h4-5H,3H2,1-2H3;7*3H,2H2,1H3.
What are the key properties of butan-2-ol;ethanol?
butan-2-ol;ethanol has a molecular weight of 396.61 g/mol, XLogP of 0.77, 1 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;ethanol is sourced from PubChem (CID 174347632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).