C7H20O4 — CID 172702663
ethane-1,2-diol;ethanol;propan-2-ol (PubChem CID 172702663) has the molecular formula C7H20O4 and a molecular weight of 168.23 g/mol. Its IUPAC name is ethane-1,2-diol;ethanol;propan-2-ol.
| Compound Name | ethane-1,2-diol;ethanol;propan-2-ol |
|---|---|
| PubChem CID | 172702663 |
| Molecular Formula | C7H20O4 |
| Molecular Weight | 168.23 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | ethane-1,2-diol;ethanol;propan-2-ol |
| SMILES | CC(C)O.CCO.OCCO |
| InChI | InChI=1S/C3H8O.C2H6O2.C2H6O/c1-3(2)4;3-1-2-4;1-2-3/h3-4H,1-2H3;3-4H,1-2H2;3H,2H2,1H3 |
| InChIKey | DEBPRCLSNJWCQL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |