C6H16O3 — CID 88835658
butane-1,3-diol;ethanol (PubChem CID 88835658) has the molecular formula C6H16O3 and a molecular weight of 136.19 g/mol. Its IUPAC name is butane-1,3-diol;ethanol.
| Compound Name | butane-1,3-diol;ethanol |
|---|---|
| PubChem CID | 88835658 |
| Molecular Formula | C6H16O3 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | butane-1,3-diol;ethanol |
| SMILES | CC(O)CCO.CCO |
| InChI | InChI=1S/C4H10O2.C2H6O/c1-4(6)2-3-5;1-2-3/h4-6H,2-3H2,1H3;3H,2H2,1H3 |
| InChIKey | AAFIBPAFMTWDBF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |