About butane-1,3-diol
butane-1,3-diol (PubChem CID 159666523) has the molecular formula C12H30O6
and a molecular weight of 270.37 g/mol. Its IUPAC name is butane-1,3-diol.
Molecular Properties
| Compound Name | butane-1,3-diol |
| PubChem CID | 159666523 |
| Molecular Formula | C12H30O6 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | butane-1,3-diol |
| SMILES | CC(O)CCO.CC(O)CCO.CC(O)CCO |
| InChI | InChI=1S/3C4H10O2/c3*1-4(6)2-3-5/h3*4-6H,2-3H2,1H3 |
| InChIKey | MTLYQGLRUSYQER-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze butane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,3-diol?
The IUPAC name of butane-1,3-diol (CID 159666523) is butane-1,3-diol.
What is the SMILES notation for butane-1,3-diol?
The canonical SMILES for butane-1,3-diol is CC(O)CCO.CC(O)CCO.CC(O)CCO.
What is the InChIKey of butane-1,3-diol?
The InChIKey is MTLYQGLRUSYQER-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H10O2/c3*1-4(6)2-3-5/h3*4-6H,2-3H2,1H3.
What are the key properties of butane-1,3-diol?
butane-1,3-diol has a molecular weight of 270.37 g/mol, XLogP of -0.75, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,3-diol is sourced from PubChem (CID 159666523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).