C12H30O6 — CID 159666523
butane-1,3-diol (PubChem CID 159666523) has the molecular formula C12H30O6 and a molecular weight of 270.37 g/mol. Its IUPAC name is butane-1,3-diol.
| Compound Name | butane-1,3-diol |
|---|---|
| PubChem CID | 159666523 |
| Molecular Formula | C12H30O6 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | butane-1,3-diol |
| SMILES | CC(O)CCO.CC(O)CCO.CC(O)CCO |
| InChI | InChI=1S/3C4H10O2/c3*1-4(6)2-3-5/h3*4-6H,2-3H2,1H3 |
| InChIKey | MTLYQGLRUSYQER-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |