About hexadecane-1,15-diol
hexadecane-1,15-diol (PubChem CID 53400630) has the molecular formula C16H34O2
and a molecular weight of 258.45 g/mol. Its IUPAC name is hexadecane-1,15-diol.
Molecular Properties
| Compound Name | hexadecane-1,15-diol |
| PubChem CID | 53400630 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | hexadecane-1,15-diol |
| SMILES | CC(O)CCCCCCCCCCCCCCO |
| InChI | InChI=1S/C16H34O2/c1-16(18)14-12-10-8-6-4-2-3-5-7-9-11-13-15-17/h16-18H,2-15H2,1H3 |
| InChIKey | SNEHHJRJHVGAII-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecane-1,15-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecane-1,15-diol?
The IUPAC name of hexadecane-1,15-diol (CID 53400630) is hexadecane-1,15-diol.
What is the SMILES notation for hexadecane-1,15-diol?
The canonical SMILES for hexadecane-1,15-diol is CC(O)CCCCCCCCCCCCCCO.
What is the InChIKey of hexadecane-1,15-diol?
The InChIKey is SNEHHJRJHVGAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2/c1-16(18)14-12-10-8-6-4-2-3-5-7-9-11-13-15-17/h16-18H,2-15H2,1H3.
What are the key properties of hexadecane-1,15-diol?
hexadecane-1,15-diol has a molecular weight of 258.45 g/mol, XLogP of 4.43, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecane-1,15-diol is sourced from PubChem (CID 53400630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).