C11H26O4 — CID 159179740
hexane-1,5-diol;pentane-1,1-diol (PubChem CID 159179740) has the molecular formula C11H26O4 and a molecular weight of 222.32 g/mol. Its IUPAC name is hexane-1,5-diol;pentane-1,1-diol.
| Compound Name | hexane-1,5-diol;pentane-1,1-diol |
|---|---|
| PubChem CID | 159179740 |
| Molecular Formula | C11H26O4 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | hexane-1,5-diol;pentane-1,1-diol |
| SMILES | CC(O)CCCCO.CCCCC(O)O |
| InChI | InChI=1S/C6H14O2.C5H12O2/c1-6(8)4-2-3-5-7;1-2-3-4-5(6)7/h6-8H,2-5H2,1H3;5-7H,2-4H2,1H3 |
| InChIKey | KMSUQCIABHJOJZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|