About henicosane-1,20-diol
henicosane-1,20-diol (PubChem CID 86247204) has the molecular formula C21H44O2
and a molecular weight of 328.58 g/mol. Its IUPAC name is henicosane-1,20-diol.
Molecular Properties
| Compound Name | henicosane-1,20-diol |
| PubChem CID | 86247204 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | henicosane-1,20-diol |
| SMILES | CC(O)CCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C21H44O2/c1-21(23)19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-22/h21-23H,2-20H2,1H3 |
| InChIKey | IMVBFGYOFDHKED-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze henicosane-1,20-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicosane-1,20-diol?
The IUPAC name of henicosane-1,20-diol (CID 86247204) is henicosane-1,20-diol.
What is the SMILES notation for henicosane-1,20-diol?
The canonical SMILES for henicosane-1,20-diol is CC(O)CCCCCCCCCCCCCCCCCCCO.
What is the InChIKey of henicosane-1,20-diol?
The InChIKey is IMVBFGYOFDHKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O2/c1-21(23)19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-22/h21-23H,2-20H2,1H3.
What are the key properties of henicosane-1,20-diol?
henicosane-1,20-diol has a molecular weight of 328.58 g/mol, XLogP of 6.38, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for henicosane-1,20-diol is sourced from PubChem (CID 86247204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).