C15H32O3 — CID 90439739
pentadecane-1,12,14-triol (PubChem CID 90439739) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is pentadecane-1,12,14-triol.
| Compound Name | pentadecane-1,12,14-triol |
|---|---|
| PubChem CID | 90439739 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | pentadecane-1,12,14-triol |
| SMILES | CC(O)CC(O)CCCCCCCCCCCO |
| InChI | InChI=1S/C15H32O3/c1-14(17)13-15(18)11-9-7-5-3-2-4-6-8-10-12-16/h14-18H,2-13H2,1H3 |
| InChIKey | UXFDUCBPORGFLP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|