C16H34O6 — CID 126747879
hexadecane-1,5,7,9,13,15-hexol (PubChem CID 126747879) has the molecular formula C16H34O6 and a molecular weight of 322.44 g/mol. Its IUPAC name is hexadecane-1,5,7,9,13,15-hexol.
| Compound Name | hexadecane-1,5,7,9,13,15-hexol |
|---|---|
| PubChem CID | 126747879 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | hexadecane-1,5,7,9,13,15-hexol |
| SMILES | CC(O)CC(O)CCCC(O)CC(O)CC(O)CCCCO |
| InChI | InChI=1S/C16H34O6/c1-12(18)9-13(19)6-4-7-15(21)11-16(22)10-14(20)5-2-3-8-17/h12-22H,2-11H2,1H3 |
| InChIKey | JXHXXKOBGSKPQO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|