C10H22O4 — CID 87436016
decane-2,4,7,9-tetrol (PubChem CID 87436016) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is decane-2,4,7,9-tetrol.
| Compound Name | decane-2,4,7,9-tetrol |
|---|---|
| PubChem CID | 87436016 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | decane-2,4,7,9-tetrol |
| SMILES | CC(O)CC(O)CCC(O)CC(C)O |
| InChI | InChI=1S/C10H22O4/c1-7(11)5-9(13)3-4-10(14)6-8(2)12/h7-14H,3-6H2,1-2H3 |
| InChIKey | ZZVNVIZYGPROJP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |