C10H22O4S — CID 139888300
1-(2,4-dihydroxypentylsulfanyl)pentane-2,4-diol (PubChem CID 139888300) has the molecular formula C10H22O4S and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(2,4-dihydroxypentylsulfanyl)pentane-2,4-diol.
| Compound Name | 1-(2,4-dihydroxypentylsulfanyl)pentane-2,4-diol |
|---|---|
| PubChem CID | 139888300 |
| Molecular Formula | C10H22O4S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1-(2,4-dihydroxypentylsulfanyl)pentane-2,4-diol |
| SMILES | CC(O)CC(O)CSCC(O)CC(C)O |
| InChI | InChI=1S/C10H22O4S/c1-7(11)3-9(13)5-15-6-10(14)4-8(2)12/h7-14H,3-6H2,1-2H3 |
| InChIKey | ZHDYSINNEYMCLX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |