C6H14O3S — CID 106933414
3-[(2R)-2-hydroxypropyl]sulfanylpropane-1,2-diol (PubChem CID 106933414) has the molecular formula C6H14O3S and a molecular weight of 166.24 g/mol. Its IUPAC name is 3-[(2R)-2-hydroxypropyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[(2R)-2-hydroxypropyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 106933414 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 3-[(2R)-2-hydroxypropyl]sulfanylpropane-1,2-diol |
| SMILES | C[C@@H](O)CSCC(O)CO |
| InChI | InChI=1S/C6H14O3S/c1-5(8)3-10-4-6(9)2-7/h5-9H,2-4H2,1H3/t5-,6?/m1/s1 |
| InChIKey | SYCZOFDOBDJYAY-LWOQYNTDSA-N |
| XLogP | -0.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |