C8H19NO2S — CID 79671997
3-(2-aminopentylsulfanyl)propane-1,2-diol (PubChem CID 79671997) has the molecular formula C8H19NO2S and a molecular weight of 193.31 g/mol. Its IUPAC name is 3-(2-aminopentylsulfanyl)propane-1,2-diol.
| Compound Name | 3-(2-aminopentylsulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 79671997 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-(2-aminopentylsulfanyl)propane-1,2-diol |
| SMILES | CCCC(N)CSCC(O)CO |
| InChI | InChI=1S/C8H19NO2S/c1-2-3-7(9)5-12-6-8(11)4-10/h7-8,10-11H,2-6,9H2,1H3 |
| InChIKey | UVFIUZBPQRHHBV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |