C12H24O3S — CID 89007958
3-(3-butoxy-2-methylbut-3-enyl)sulfanylpropane-1,2-diol (PubChem CID 89007958) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-(3-butoxy-2-methylbut-3-enyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(3-butoxy-2-methylbut-3-enyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 89007958 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-(3-butoxy-2-methylbut-3-enyl)sulfanylpropane-1,2-diol |
| SMILES | C=C(OCCCC)C(C)CSCC(O)CO |
| InChI | InChI=1S/C12H24O3S/c1-4-5-6-15-11(3)10(2)8-16-9-12(14)7-13/h10,12-14H,3-9H2,1-2H3 |
| InChIKey | WCYZYBAIUMGTOD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|