C11H24O3S — CID 88603626
3-octoxysulfanylpropane-1,2-diol (PubChem CID 88603626) has the molecular formula C11H24O3S and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-octoxysulfanylpropane-1,2-diol.
| Compound Name | 3-octoxysulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 88603626 |
| Molecular Formula | C11H24O3S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-octoxysulfanylpropane-1,2-diol |
| SMILES | CCCCCCCCOSCC(O)CO |
| InChI | InChI=1S/C11H24O3S/c1-2-3-4-5-6-7-8-14-15-10-11(13)9-12/h11-13H,2-10H2,1H3 |
| InChIKey | UJVZBUUGGCLDIT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|