C12H30N2O4 — CID 170888613
4-aminohexane-1,2-diol (PubChem CID 170888613) has the molecular formula C12H30N2O4 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-aminohexane-1,2-diol.
| Compound Name | 4-aminohexane-1,2-diol |
|---|---|
| PubChem CID | 170888613 |
| Molecular Formula | C12H30N2O4 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 4-aminohexane-1,2-diol |
| SMILES | CCC(N)CC(O)CO.CCC(N)CC(O)CO |
| InChI | InChI=1S/2C6H15NO2/c2*1-2-5(7)3-6(9)4-8/h2*5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | WPCCLLBPANWXEX-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |