C6H16N2O — CID 89425679
(3R)-5,6-diaminohexan-3-ol (PubChem CID 89425679) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is (3R)-5,6-diaminohexan-3-ol.
| Compound Name | (3R)-5,6-diaminohexan-3-ol |
|---|---|
| PubChem CID | 89425679 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | (3R)-5,6-diaminohexan-3-ol |
| SMILES | CC[C@@H](O)CC(N)CN |
| InChI | InChI=1S/C6H16N2O/c1-2-6(9)3-5(8)4-7/h5-6,9H,2-4,7-8H2,1H3/t5?,6-/m1/s1 |
| InChIKey | CPMKGIAFVVWZFF-PRJDIBJQSA-N |
| XLogP | -0.57 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |