C7H21N3O — CID 159214940
1-aminobutan-2-ol;propane-1,3-diamine (PubChem CID 159214940) has the molecular formula C7H21N3O and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-aminobutan-2-ol;propane-1,3-diamine.
| Compound Name | 1-aminobutan-2-ol;propane-1,3-diamine |
|---|---|
| PubChem CID | 159214940 |
| Molecular Formula | C7H21N3O |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.17 |
| IUPAC Name | 1-aminobutan-2-ol;propane-1,3-diamine |
| SMILES | CCC(O)CN.NCCCN |
| InChI | InChI=1S/C4H11NO.C3H10N2/c1-2-4(6)3-5;4-2-1-3-5/h4,6H,2-3,5H2,1H3;1-5H2 |
| InChIKey | KQYIBRKVXGQNCK-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |