About 1-aminobutan-2-ol;3-aminobutan-2-ol
1-aminobutan-2-ol;3-aminobutan-2-ol (PubChem CID 159145044) has the molecular formula C8H22N2O2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-aminobutan-2-ol;3-aminobutan-2-ol.
Molecular Properties
| Compound Name | 1-aminobutan-2-ol;3-aminobutan-2-ol |
| PubChem CID | 159145044 |
| Molecular Formula | C8H22N2O2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1-aminobutan-2-ol;3-aminobutan-2-ol |
| SMILES | CC(N)C(C)O.CCC(O)CN |
| InChI | InChI=1S/2C4H11NO/c1-3(5)4(2)6;1-2-4(6)3-5/h3-4,6H,5H2,1-2H3;4,6H,2-3,5H2,1H3 |
| InChIKey | KIONWDWDZVNYAH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-aminobutan-2-ol;3-aminobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminobutan-2-ol;3-aminobutan-2-ol?
The IUPAC name of 1-aminobutan-2-ol;3-aminobutan-2-ol (CID 159145044) is 1-aminobutan-2-ol;3-aminobutan-2-ol.
What is the SMILES notation for 1-aminobutan-2-ol;3-aminobutan-2-ol?
The canonical SMILES for 1-aminobutan-2-ol;3-aminobutan-2-ol is CC(N)C(C)O.CCC(O)CN.
What is the InChIKey of 1-aminobutan-2-ol;3-aminobutan-2-ol?
The InChIKey is KIONWDWDZVNYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11NO/c1-3(5)4(2)6;1-2-4(6)3-5/h3-4,6H,5H2,1-2H3;4,6H,2-3,5H2,1H3.
What are the key properties of 1-aminobutan-2-ol;3-aminobutan-2-ol?
1-aminobutan-2-ol;3-aminobutan-2-ol has a molecular weight of 178.28 g/mol, XLogP of -0.57, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminobutan-2-ol;3-aminobutan-2-ol is sourced from PubChem (CID 159145044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).