C4H12NO+ — CID 173377832
(2R,3R)-3-aminobutan-2-ol;hydron (PubChem CID 173377832) has the molecular formula C4H12NO+ and a molecular weight of 90.15 g/mol. Its IUPAC name is (2R,3R)-3-aminobutan-2-ol;hydron.
| Compound Name | (2R,3R)-3-aminobutan-2-ol;hydron |
|---|---|
| PubChem CID | 173377832 |
| Molecular Formula | C4H12NO+ |
| Molecular Weight | 90.15 g/mol |
| Exact Mass | 90.09 |
| IUPAC Name | (2R,3R)-3-aminobutan-2-ol;hydron |
| SMILES | C[C@@H](N)[C@@H](C)O.[H+] |
| InChI | InChI=1S/C4H11NO/c1-3(5)4(2)6/h3-4,6H,5H2,1-2H3/p+1/t3-,4-/m1/s1 |
| InChIKey | FERWBXLFSBWTDE-QWWZWVQMSA-O |
| XLogP | -0.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |