About 1-aminoethanol;dihydrate
1-aminoethanol;dihydrate (PubChem CID 174522772) has the molecular formula C2H11NO3
and a molecular weight of 97.11 g/mol. Its IUPAC name is 1-aminoethanol;dihydrate.
Molecular Properties
| Compound Name | 1-aminoethanol;dihydrate |
| PubChem CID | 174522772 |
| Molecular Formula | C2H11NO3 |
| Molecular Weight | 97.11 g/mol |
| Exact Mass | 97.07 |
| IUPAC Name | 1-aminoethanol;dihydrate |
| SMILES | CC(N)O.O.O |
| InChI | InChI=1S/C2H7NO.2H2O/c1-2(3)4;;/h2,4H,3H2,1H3;2*1H2 |
| InChIKey | UWMDUAYNMWHPLY-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.11 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethanol;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethanol;dihydrate?
The IUPAC name of 1-aminoethanol;dihydrate (CID 174522772) is 1-aminoethanol;dihydrate.
What is the SMILES notation for 1-aminoethanol;dihydrate?
The canonical SMILES for 1-aminoethanol;dihydrate is CC(N)O.O.O.
What is the InChIKey of 1-aminoethanol;dihydrate?
The InChIKey is UWMDUAYNMWHPLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO.2H2O/c1-2(3)4;;/h2,4H,3H2,1H3;2*1H2.
What are the key properties of 1-aminoethanol;dihydrate?
1-aminoethanol;dihydrate has a molecular weight of 97.11 g/mol, XLogP of -2.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethanol;dihydrate is sourced from PubChem (CID 174522772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).