C5H14N2O — CID 88907217
2,4-diaminopentan-3-ol (PubChem CID 88907217) has the molecular formula C5H14N2O and a molecular weight of 118.18 g/mol. Its IUPAC name is 2,4-diaminopentan-3-ol.
| Compound Name | 2,4-diaminopentan-3-ol |
|---|---|
| PubChem CID | 88907217 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 2,4-diaminopentan-3-ol |
| SMILES | CC(N)C(O)C(C)N |
| InChI | InChI=1S/C5H14N2O/c1-3(6)5(8)4(2)7/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | OSQCEMOJHDKFJY-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |