About 2,4-diaminopentan-3-ol
2,4-diaminopentan-3-ol (PubChem CID 88907217) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is 2,4-diaminopentan-3-ol.
Molecular Properties
| Compound Name | 2,4-diaminopentan-3-ol |
| PubChem CID | 88907217 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 2,4-diaminopentan-3-ol |
| SMILES | CC(N)C(O)C(C)N |
| InChI | InChI=1S/C5H14N2O/c1-3(6)5(8)4(2)7/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | OSQCEMOJHDKFJY-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-diaminopentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diaminopentan-3-ol?
The IUPAC name of 2,4-diaminopentan-3-ol (CID 88907217) is 2,4-diaminopentan-3-ol.
What is the SMILES notation for 2,4-diaminopentan-3-ol?
The canonical SMILES for 2,4-diaminopentan-3-ol is CC(N)C(O)C(C)N.
What is the InChIKey of 2,4-diaminopentan-3-ol?
The InChIKey is OSQCEMOJHDKFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2O/c1-3(6)5(8)4(2)7/h3-5,8H,6-7H2,1-2H3.
What are the key properties of 2,4-diaminopentan-3-ol?
2,4-diaminopentan-3-ol has a molecular weight of 118.18 g/mol, XLogP of -0.96, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diaminopentan-3-ol is sourced from PubChem (CID 88907217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).