About (2R,3R)-butane-2,3-diamine;dihydrochloride
(2R,3R)-butane-2,3-diamine;dihydrochloride (PubChem CID 90474575) has the molecular formula C4H14Cl2N2
and a molecular weight of 161.08 g/mol. Its IUPAC name is (2R,3R)-butane-2,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | (2R,3R)-butane-2,3-diamine;dihydrochloride |
| PubChem CID | 90474575 |
| Molecular Formula | C4H14Cl2N2 |
| Molecular Weight | 161.08 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (2R,3R)-butane-2,3-diamine;dihydrochloride |
| SMILES | C[C@@H](N)[C@@H](C)N.Cl.Cl |
| InChI | InChI=1S/C4H12N2.2ClH/c1-3(5)4(2)6;;/h3-4H,5-6H2,1-2H3;2*1H/t3-,4-;;/m1../s1 |
| InChIKey | UEGFKFNFTYLWMM-XWJKVJTJSA-N |
| XLogP | 0.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.08 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3R)-butane-2,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-butane-2,3-diamine;dihydrochloride?
The IUPAC name of (2R,3R)-butane-2,3-diamine;dihydrochloride (CID 90474575) is (2R,3R)-butane-2,3-diamine;dihydrochloride.
What is the SMILES notation for (2R,3R)-butane-2,3-diamine;dihydrochloride?
The canonical SMILES for (2R,3R)-butane-2,3-diamine;dihydrochloride is C[C@@H](N)[C@@H](C)N.Cl.Cl.
What is the InChIKey of (2R,3R)-butane-2,3-diamine;dihydrochloride?
The InChIKey is UEGFKFNFTYLWMM-XWJKVJTJSA-N. The full InChI is InChI=1S/C4H12N2.2ClH/c1-3(5)4(2)6;;/h3-4H,5-6H2,1-2H3;2*1H/t3-,4-;;/m1../s1.
What are the key properties of (2R,3R)-butane-2,3-diamine;dihydrochloride?
(2R,3R)-butane-2,3-diamine;dihydrochloride has a molecular weight of 161.08 g/mol, XLogP of 0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-butane-2,3-diamine;dihydrochloride is sourced from PubChem (CID 90474575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).