C4H14Cl2N2 — CID 90474575
(2R,3R)-butane-2,3-diamine;dihydrochloride (PubChem CID 90474575) has the molecular formula C4H14Cl2N2 and a molecular weight of 161.08 g/mol. Its IUPAC name is (2R,3R)-butane-2,3-diamine;dihydrochloride.
| Compound Name | (2R,3R)-butane-2,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 90474575 |
| Molecular Formula | C4H14Cl2N2 |
| Molecular Weight | 161.08 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (2R,3R)-butane-2,3-diamine;dihydrochloride |
| SMILES | C[C@@H](N)[C@@H](C)N.Cl.Cl |
| InChI | InChI=1S/C4H12N2.2ClH/c1-3(5)4(2)6;;/h3-4H,5-6H2,1-2H3;2*1H/t3-,4-;;/m1../s1 |
| InChIKey | UEGFKFNFTYLWMM-XWJKVJTJSA-N |
| XLogP | 0.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.08 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |