About propane-1,2-diamine
propane-1,2-diamine (PubChem CID 6567) has the molecular formula C3H10N2
and a molecular weight of 74.13 g/mol. Its IUPAC name is propane-1,2-diamine.
Molecular Properties
| Compound Name | propane-1,2-diamine |
| PubChem CID | 6567 |
| Molecular Formula | C3H10N2 |
| Molecular Weight | 74.13 g/mol |
| Exact Mass | 74.08 |
| IUPAC Name | propane-1,2-diamine |
| SMILES | CC(N)CN |
| InChI | InChI=1S/C3H10N2/c1-3(5)2-4/h3H,2,4-5H2,1H3 |
| InChIKey | AOHJOMMDDJHIJH-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.13 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,2-diamine?
The IUPAC name of propane-1,2-diamine (CID 6567) is propane-1,2-diamine.
What is the SMILES notation for propane-1,2-diamine?
The canonical SMILES for propane-1,2-diamine is CC(N)CN.
What is the InChIKey of propane-1,2-diamine?
The InChIKey is AOHJOMMDDJHIJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2/c1-3(5)2-4/h3H,2,4-5H2,1H3.
What are the key properties of propane-1,2-diamine?
propane-1,2-diamine has a molecular weight of 74.13 g/mol, XLogP of -0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,2-diamine is sourced from PubChem (CID 6567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).