C3H10N2 — CID 642322
(2S)-propane-1,2-diamine (PubChem CID 642322) has the molecular formula C3H10N2 and a molecular weight of 74.13 g/mol. Its IUPAC name is (2S)-propane-1,2-diamine.
| Compound Name | (2S)-propane-1,2-diamine |
|---|---|
| PubChem CID | 642322 |
| Molecular Formula | C3H10N2 |
| Molecular Weight | 74.13 g/mol |
| Exact Mass | 74.08 |
| IUPAC Name | (2S)-propane-1,2-diamine |
| SMILES | C[C@H](N)CN |
| InChI | InChI=1S/C3H10N2/c1-3(5)2-4/h3H,2,4-5H2,1H3/t3-/m0/s1 |
| InChIKey | AOHJOMMDDJHIJH-VKHMYHEASA-N |
| XLogP | -0.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 74.13 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |