C4H18N5O4P — CID 87429933
guanidine;phosphoric acid;propane-1,2-diamine (PubChem CID 87429933) has the molecular formula C4H18N5O4P and a molecular weight of 231.19 g/mol. Its IUPAC name is guanidine;phosphoric acid;propane-1,2-diamine.
| Compound Name | guanidine;phosphoric acid;propane-1,2-diamine |
|---|---|
| PubChem CID | 87429933 |
| Molecular Formula | C4H18N5O4P |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | guanidine;phosphoric acid;propane-1,2-diamine |
| SMILES | CC(N)CN.O=P(O)(O)O.[H]N=C(N)N |
| InChI | InChI=1S/C3H10N2.CH5N3.H3O4P/c1-3(5)2-4;2-1(3)4;1-5(2,3)4/h3H,2,4-5H2,1H3;(H5,2,3,4);(H3,1,2,3,4) |
| InChIKey | GEGNYDHDVITYHY-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 205.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|