C9H28N2O3 — CID 161334035
ethanol;propane-1,2-diamine (PubChem CID 161334035) has the molecular formula C9H28N2O3 and a molecular weight of 212.33 g/mol. Its IUPAC name is ethanol;propane-1,2-diamine.
| Compound Name | ethanol;propane-1,2-diamine |
|---|---|
| PubChem CID | 161334035 |
| Molecular Formula | C9H28N2O3 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | ethanol;propane-1,2-diamine |
| SMILES | CC(N)CN.CCO.CCO.CCO |
| InChI | InChI=1S/C3H10N2.3C2H6O/c1-3(5)2-4;3*1-2-3/h3H,2,4-5H2,1H3;3*3H,2H2,1H3 |
| InChIKey | VLUHRHGSGUOWIN-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |